| Melting point |
185-187 °C (lit.) |
| Boiling point |
397.76°C (rough estimate) |
| alpha |
67 º (c=26, in water 25 ºC) |
| Density |
1.5805 |
| bulk density |
800-950kg/m3 |
| refractive index |
66.5 ° (C=26, H2O) |
| Flash point |
93.3°C |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
H2O: 500 mg/mL |
| form |
Liquid |
| pka |
12.7(at 25℃) |
| color |
White |
| PH |
5.0-7.0 (25℃, 1M in H2O) |
| Odor |
Odorless |
| PH Range |
5.5 - 7 at 342 g/l at 25 °C |
| optical activity |
[α]25/D +66.3 to +66.8°(lit.) |
| biological source |
sugar cane |
| Water Solubility |
1970 g/L (15 ºC) |
| λmax |
λ: 260 nm Amax: 0.11
λ: 280 nm Amax: 0.08 |
| Merck |
14,8881 |
| BRN |
90825 |
| Exposure limits |
ACGIH:TLV-TWA 10 mg/m3
OSHA:PEL-TWA 15 mg/m3 (total dust),5 mg/m3 (respirable fraction)
NIOSH:REL-TWA 10 mg/m3 (total dust),5 mg/m3 (respirable fraction) |
| Dielectric constant |
3.3(Ambient) |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. Hydrolyzed by dilute acids and by invertase. |
| Cosmetics Ingredients Functions |
HUMECTANT
SKIN CONDITIONING
SOOTHING |
| InChI |
1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey |
CZMRCDWAGMRECN-UGDNZRGBSA-N |
| SMILES |
OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP |
-4.492 (est) |
| CAS DataBase Reference |
57-50-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Sucrose(57-50-1) |
| EPA Substance Registry System |
Sucrose (57-50-1) |
| Absorption |
≤0.100 at 280nm
≤0.120 at 260nm |
