5-Methylpyridin-3-amine
- Product Name5-Methylpyridin-3-amine
- CAS3430-19-1
- MFC6H8N2
- MW108.14
- EINECS624-420-4
- MOL File3430-19-1.mol
Chemical Properties
| Melting point | 59-63 °C |
| Boiling point | 153°C |
| Density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.46±0.20(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C6H8N2/c1-5-2-6(7)4-8-3-5/h2-4H,7H2,1H3 |
| InChIKey | JXUWZXFVCBODAN-UHFFFAOYSA-N |
| SMILES | C1=NC=C(C)C=C1N |
| CAS DataBase Reference | 3430-19-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 22-37/38-41-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT, TOXIC |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
