Tri-tert-butylphosphine
- Product NameTri-tert-butylphosphine
- CAS13716-12-6
- MFC12H27P
- MW202.32
- EINECS237-266-4
- MOL File13716-12-6.mol
Chemical Properties
| Melting point | 30-35 °C(lit.) |
| Boiling point | 102-103 °C13 mm Hg(lit.) |
| Density | 0.861 g/mL at 25 °C |
| Flash point | 1 °F |
| storage temp. | Flammables area |
| form | solid |
| Specific Gravity | 0.68 |
| Water Solubility | insoluble |
| Sensitive | Air & Moisture Sensitive |
| Hydrolytic Sensitivity | 9: reacts extremely rapidly with atmospheric moisture - may be pyrophoric - glove box or sealed system required |
| BRN | 1738613 |
| InChI | InChI=1S/C12H27P/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| SMILES | P(C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 13716-12-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tri-tert-butylphosphine(13716-12-6) |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 17-34-67-65-63-48/20-11 |
| Safety Statements | 26-45-62-36/37/39-25-43-27-16 |
| RIDADR | UN 2846 4.2/PG 1 |
| WGK Germany | 3 |
| F | 10-19-23 |
| HazardClass | 4.2 |
| PackingGroup | I |
| HS Code | 29319090 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Carc. 2 Eye Dam. 1 Flam. Liq. 2 Pyr. Liq. 1 Skin Corr. 1B STOT SE 3 |
