
34160-40-2
| Name | 6-Bromopyridine-2-carbaldehyde |
| CAS | 34160-40-2 |
| EINECS(EC#) | 608-952-4 |
| Molecular Formula | C6H4BrNO |
| MDL Number | MFCD02683546 |
| Molecular Weight | 186.01 |
| MOL File | 34160-40-2.mol |
Chemical Properties
| Appearance | Light yellow Flakes |
| Melting point | 81-85 °C(lit.) |
| Boiling point | 248.2±20.0 °C(Predicted) |
| density | 1.683±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| solubility | Chloroform (Sparingly), Dichloromethane, Ether, Ethyl Acetate, Methanol (Slightl |
| form | Powder |
| pka | 1.00±0.10(Predicted) |
| color | White to beige or pale brown |
| Water Solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol. Insoluble in water. |
| Sensitive | Air Sensitive |
| Usage | A useful synthetic intermediate |
| Detection Methods | HPLC |
| BRN | 1524300 |
| InChI | InChI=1S/C6H4BrNO/c7-6-3-1-2-5(4-9)8-6/h1-4H |
| InChIKey | QWFHFNGMCPMOCD-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 34160-40-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
