6602-54-6
| Name | 2-Chloro-3-cyanopyridine |
| CAS | 6602-54-6 |
| EINECS(EC#) | 229-550-1 |
| Molecular Formula | C6H3ClN2 |
| MDL Number | MFCD00014628 |
| Molecular Weight | 138.55 |
| MOL File | 6602-54-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 104-107 °C(lit.) |
| Boiling point | 112°C 1mm |
| density | 1.3185 (rough estimate) |
| refractive index | 1.4877 (estimate) |
| Fp | 112°C/1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder or Flakes |
| pka | -2.17±0.10(Predicted) |
| color | White to off-white |
| Detection Methods | HPLC,NMR |
| BRN | 115772 |
| InChI | InChI=1S/C6H3ClN2/c7-6-5(4-8)2-1-3-9-6/h1-3H |
| InChIKey | JAUPUQRPBNDMDT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C#N |
| CAS DataBase Reference | 6602-54-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |