
14237-71-9
| Name | 2-Chloro-3-cyano-4,6-dimethylpyridine |
| CAS | 14237-71-9 |
| Molecular Formula | C8H7ClN2 |
| MDL Number | MFCD00051676 |
| Molecular Weight | 166.61 |
| MOL File | 14237-71-9.mol |
Chemical Properties
| Melting point | 98-99°C |
| Boiling point | 305.3±37.0 °C(Predicted) |
| density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -0.41±0.10(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC,NMR |
| BRN | 131348 |
| InChI | InChI=1S/C8H7ClN2/c1-5-3-6(2)11-8(9)7(5)4-10/h3H,1-2H3 |
| InChIKey | RETJKTAVEQPNMH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C)=C1C#N |
| CAS DataBase Reference | 14237-71-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P261-P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

