
33252-30-1
| Name | 2-Chloro-4-cyanopyridine |
| CAS | 33252-30-1 |
| EINECS(EC#) | 608-852-0 |
| Molecular Formula | C6H3ClN2 |
| MDL Number | MFCD00174318 |
| Molecular Weight | 138.55 |
| MOL File | 33252-30-1.mol |
Chemical Properties
| Melting point | 69-73 °C(lit.) |
| Boiling point | 104-106°C 15mm |
| density | 1.33±0.1 g/cm3(Predicted) |
| Fp | 104-106°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.60±0.10(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC,NMR |
| BRN | 113927 |
| InChI | InChI=1S/C6H3ClN2/c7-6-3-5(4-8)1-2-9-6/h1-3H |
| InChIKey | QRXBTPFMCTXCRD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C#N)=C1 |
| CAS DataBase Reference | 33252-30-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
