33252-28-7
| Name | 6-Chloronicotinonitrile |
| CAS | 33252-28-7 |
| EINECS(EC#) | 608-851-5 |
| Molecular Formula | C6H3ClN2 |
| MDL Number | MFCD00084941 |
| Molecular Weight | 138.55 |
| MOL File | 33252-28-7.mol |
Chemical Properties
| Appearance | Yellow to Brown Cryst |
| Melting point | 116-120 °C(lit.) |
| Boiling point | 105-107°C 1mm |
| density | 1.33±0.1 g/cm3(Predicted) |
| Fp | 105-107°C/1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Ethanol |
| form | powder to crystal |
| pka | -3.56±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Detection Methods | HPLC |
| BRN | 113867 |
| InChI | InChI=1S/C6H3ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H |
| InChIKey | ORIQLMBUPMABDV-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1C#N |
| CAS DataBase Reference | 33252-28-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |