
31301-51-6
| Name | 2-Chloro-5-fluoropyridine |
| CAS | 31301-51-6 |
| Molecular Formula | C5H3ClFN |
| MDL Number | MFCD03095332 |
| Molecular Weight | 131.54 |
| MOL File | 31301-51-6.mol |
Chemical Properties
| Appearance | Light yellow powder |
| Melting point | 19℃ |
| Boiling point | 74 °C / 38mmHg |
| density | 1.297 g/mL at 25 °C |
| refractive index | n |
| Fp | 108 °C |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to lump to clear liquid |
| pka | -2.20±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| Detection Methods | GC,NMR |
| InChI | InChI=1S/C5H3ClFN/c6-5-2-1-4(7)3-8-5/h1-3H |
| InChIKey | QOGXQLSFJCIDNY-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C=C1 |
| CAS DataBase Reference | 31301-51-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H315-H318-H335 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |


