5-Amino-2-chloropyridine
- Product Name5-Amino-2-chloropyridine
- CAS5350-93-6
- MFC5H5ClN2
- MW128.56
- EINECS226-322-3
- MOL File5350-93-6.mol
Chemical Properties
| Melting point | 81-83 °C(lit.) |
| Boiling point | 205.39°C (rough estimate) |
| Density | 1.2417 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.94±0.10(Predicted) |
| form | powder to crystal |
| color | White to Brown |
| BRN | 108891 |
| InChI | InChI=1S/C5H5ClN2/c6-5-2-1-4(7)3-8-5/h1-3H,7H2 |
| InChIKey | QAJYCQZQLVENRZ-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1N |
| CAS DataBase Reference | 5350-93-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |