2546-56-7
| Name | 4-Chloro-3-fluoropyridine |
| CAS | 2546-56-7 |
| EINECS(EC#) | 629-495-7 |
| Molecular Formula | C5H3ClFN |
| MDL Number | MFCD03453233 |
| Molecular Weight | 131.54 |
| MOL File | 2546-56-7.mol |
Chemical Properties
| Appearance | Light yellow liquid |
| Melting point | -24°C(lit.) |
| Boiling point | 139°C(lit.) |
| density | 1.333 g/mL at 25 °C(lit.) |
| refractive index | 1.5010 to 1.5050 |
| Fp | 82.4 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 1.93±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| BRN | 1422747 |
| InChI | InChI=1S/C5H3ClFN/c6-4-1-2-8-3-5(4)7/h1-3H |
| InChIKey | BEQUUSCRAKEKQM-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(Cl)=C1F |
| CAS DataBase Reference | 2546-56-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |