4548-45-2
| Name | 2-Chloro-5-nitropyridine |
| CAS | 4548-45-2 |
| EINECS(EC#) | 224-908-3 |
| Molecular Formula | C5H3ClN2O2 |
| MDL Number | MFCD00234050 |
| Molecular Weight | 158.54 |
| MOL File | 4548-45-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal |
| Melting point | 105-108 °C (lit.) |
| Boiling point | 256.6±20.0 °C(Predicted) |
| density | 1.6616 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Fp | 158°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | -4.22±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Solubility in hot methanol. Insoluble in water. |
| Detection Methods | HPLC,GC,NMR |
| BRN | 120453 |
| InChI | InChI=1S/C5H3ClN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | BAZVFQBTJPBRTJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 4548-45-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-5-nitropyridine(4548-45-2) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | US7175000 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |