2-Hydroxy-5-nitropyridine
- Product Name2-Hydroxy-5-nitropyridine
- CAS5418-51-9
- MFC5H4N2O3
- MW140.1
- EINECS226-525-7
- MOL File5418-51-9.mol
Chemical Properties
| Melting point | 188-191 °C (lit.) |
| Boiling point | 256.56°C (rough estimate) |
| Density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Crystalline Powder |
| pka | 8.06±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Soluble in hot water and alkali liquor, Insoluble in most of organic solvents. |
| BRN | 120352 |
| InChI | InChI=1S/C5H4N2O3/c8-5-2-1-4(3-6-5)7(9)10/h1-3H,(H,6,8) |
| InChIKey | XKWSQIMYNVLGBO-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 5418-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxy-5-nitropyridine(5418-51-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
