2,3-Dichloro-5-nitropyridine
- Product Name2,3-Dichloro-5-nitropyridine
- CAS22353-40-8
- MFC5H2Cl2N2O2
- MW192.99
- EINECS200-258-5
- MOL File22353-40-8.mol
Chemical Properties
| Melting point | 51-56℃ |
| Boiling point | 256°C(lit.) |
| Density | 1.629±0.06 g/cm3(Predicted) |
| Flash point | >110°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -4.99±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H |
| InChIKey | XLPDVAVQKGDHNO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 22353-40-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-43-41-37/38-25 |
| Safety Statements | 26-36/37/39-45-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
