5-Amino-2-methylpyridine
- Product Name5-Amino-2-methylpyridine
- CAS3430-14-6
- MFC6H8N2
- MW108.14
- EINECS625-232-5
- MOL File3430-14-6.mol
Chemical Properties
| Melting point | 95-99°C |
| Boiling point | 238.4±20.0 °C(Predicted) |
| Density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 6.89±0.10(Predicted) |
| color | Off-white to orange to brown |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-6(7)4-8-5/h2-4H,7H2,1H3 |
| InChIKey | UENBBJXGCWILBM-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1N |
| LogP | 0.704 |
| CAS DataBase Reference | 3430-14-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 22-37/38-41-36/37/38-34-24/25 |
| Safety Statements | 26-36/39-45-36/37/39-36-27-36/37 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333999 |
