2-Bromo-6-methylpyridine
- Product Name2-Bromo-6-methylpyridine
- CAS5315-25-3
- MFC6H6BrN
- MW172.02
- EINECS226-173-4
- MOL File5315-25-3.mol
Chemical Properties
| Boiling point | 102-103 °C/20 mmHg (lit.) |
| Density | 1.512 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 207 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethyl Aceate |
| form | Liquid |
| pka | 1.51±0.10(Predicted) |
| Specific Gravity | 1.512 |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in chloroform, ethyl aceate. Not miscible or difficult to mix with water. |
| BRN | 107322 |
| InChI | InChI=1S/C6H6BrN/c1-5-3-2-4-6(7)8-5/h2-4H,1H3 |
| InChIKey | SOHDPICLICFSOP-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(C)=CC=C1 |
| CAS DataBase Reference | 5315-25-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |