| Boiling point |
102-103 °C/20 mmHg (lit.) |
| Density |
1.512 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.562(lit.) |
| Flash point |
207 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Chloroform, Ethyl Aceate |
| form |
Liquid |
| pka |
1.51±0.10(Predicted) |
| Specific Gravity |
1.512 |
| color |
Clear colorless to yellow |
| Water Solubility |
Soluble in chloroform, ethyl aceate. Not miscible or difficult to mix with water. |
| BRN |
107322 |
| InChI |
InChI=1S/C6H6BrN/c1-5-3-2-4-6(7)8-5/h2-4H,1H3 |
| InChIKey |
SOHDPICLICFSOP-UHFFFAOYSA-N |
| SMILES |
C1(Br)=NC(C)=CC=C1 |
| CAS DataBase Reference |
5315-25-3(CAS DataBase Reference) |
