
31181-90-5
| Name | 5-Bromopyridine-2-carbaldehyde |
| CAS | 31181-90-5 |
| EINECS(EC#) | 626-872-8 |
| Molecular Formula | C6H4BrNO |
| MDL Number | MFCD04112535 |
| Molecular Weight | 186.01 |
| MOL File | 31181-90-5.mol |
Chemical Properties
| Appearance | Light yellow Cryst |
| Melting point | 91-96 °C |
| Boiling point | 70°C/26mmHg(lit.) |
| density | 1.683±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 1.36±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H4BrNO/c7-5-1-2-6(4-9)8-3-5/h1-4H |
| InChIKey | ZQVLPMNLLKGGIU-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 31181-90-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
