3-Amino-4-methylpyridine
- Product Name3-Amino-4-methylpyridine
- CAS3430-27-1
- MFC6H8N2
- MW108.14
- EINECS608-968-1
- MOL File3430-27-1.mol
Chemical Properties
| Melting point | 102-107 °C |
| Boiling point | 254°C |
| Density | 1.0275 (estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point | 254°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | powder to crystal |
| pka | 6.83±0.18(Predicted) |
| color | White to Brown |
| Sensitive | Hygroscopic |
| BRN | 107792 |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-4H,7H2,1H3 |
| InChIKey | IBKMZYWDWWIWEL-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1N |
| CAS DataBase Reference | 3430-27-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinamine, 4-methyl-(3430-27-1) |
Safety Information
| Hazard Codes | T,Xn |
| Risk Statements | 23/24/25-36/37/38-41-37/38-22-20/21/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
