3-Amino-4-methylpyridine
- Product Name3-Amino-4-methylpyridine
- CAS3430-27-1
- CBNumberCB9149173
- MFC6H8N2
- MW108.14
- EINECS608-968-1
- MDL NumberMFCD00128871
- MOL File3430-27-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 102-107 °C |
| Boiling point | 254°C |
| Density | 1.0275 (estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point | 254°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | powder to crystal |
| pka | 6.83±0.18(Predicted) |
| color | White to Brown |
| Sensitive | Hygroscopic |
| BRN | 107792 |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-4H,7H2,1H3 |
| InChIKey | IBKMZYWDWWIWEL-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1N |
| CAS DataBase Reference | 3430-27-1(CAS DataBase Reference) |
| FDA UNII | 9HN55RQ07B |
| NIST Chemistry Reference | 3-Pyridinamine, 4-methyl-(3430-27-1) |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xn | |||||||||
| Risk Statements | 23/24/25-36/37/38-41-37/38-22-20/21/22 | |||||||||
| Safety Statements | 26-36/37/39-45-36 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
