Benzyltriphenylphosphonium chloride
- Product NameBenzyltriphenylphosphonium chloride
- CAS1100-88-5
- MFC25H22ClP
- MW388.87
- EINECS214-154-3
- MOL File1100-88-5.mol
Chemical Properties
| Melting point | ≥300 °C (lit.) |
| Density | 1.18 g/cm3 (20℃) |
| vapor pressure | 0.1 hPa |
| Flash point | 300°C |
| storage temp. | Store at <= 20°C. |
| form | Crystalline Powder |
| color | White to almost white |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| BRN | 3599868 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C25H22P.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;1H/q+1;/p-1 |
| InChIKey | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| SMILES | [Cl-].C(c1ccccc1)[P+](c2ccccc2)(c3ccccc3)c4ccccc4 |
| LogP | -0.7 at 20℃ |
| CAS DataBase Reference | 1100-88-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonium, triphenyl(phenylmethyl)-, chloride (1100-88-5) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-24/25 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TA2416500 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 STOT RE 1 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 43 mg/kg |
