Dichlorotriphenylphosphorane
- Product NameDichlorotriphenylphosphorane
- CAS2526-64-9
- MFC18H15Cl2P
- MW333.19
- EINECS607-677-7
- MOL File2526-64-9.mol
Chemical Properties
| Melting point | 85 °C (dec.) (lit.) |
| Flash point | 68 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Soluble), Dichloromethane (Slightly) |
| form | Solid |
| color | White to Light Yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Stability | Extremely Moisture Sensitive, Hygroscopic |
| InChI | InChI=1S/C18H15Cl2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | ASWXNYNXAOQCCD-UHFFFAOYSA-N |
| SMILES | P(Cl)(Cl)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 45-11-34 |
| Safety Statements | 53-26-36/37/39-45-16 |
| RIDADR | UN 2925 4.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Carc. 1B Eye Dam. 1 Flam. Sol. 2 Skin Corr. 1B |