Gestodene
- Product NameGestodene
- CAS60282-87-3
- MFC21H26O2
- MW310.43
- EINECS262-145-8
- MOL File60282-87-3.mol
Chemical Properties
| Melting point | 190-192°C |
| Boiling point | 462.7±45.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO: >20mg/mL |
| pka | 12.16±0.40(Predicted) |
| form | powder |
| color | white to off-white |
| optical activity | [α]/D -175 to -195° (DCM) |
| λmax | 240nm(MeOH)(lit.) |
| Merck | 14,4413 |
| InChI | InChI=1S/C21H26O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,10,12-13,16-19,23H,3,5-9,11H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | SIGSPDASOTUPFS-XUDSTZEESA-N |
| SMILES | C1C[C@]2([H])[C@@]3([H])CC[C@]4(CC)[C@@](C#C)(O)C=C[C@@]4([H])[C@]3([H])CCC2=CC1=O |
| CAS DataBase Reference | 60282-87-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 62 |
| Safety Statements | 36/37-24/25 |
| WGK Germany | 3 |
| RTECS | JF7956000 |
| HS Code | 29144000 |
| Hazardous Substances Data | 60282-87-3(Hazardous Substances Data) |