39906-04-2
| Name | 5-Amino-4,6-dichloro-2-methylpyrimidine |
| CAS | 39906-04-2 |
| EINECS(EC#) | 419-110-9 |
| Molecular Formula | C5H5Cl2N3 |
| MDL Number | MFCD00194053 |
| Molecular Weight | 178.02 |
| MOL File | 39906-04-2.mol |
Chemical Properties
| Melting point | 70-73 °C (lit.) |
| Boiling point | 257.7±35.0 °C(Predicted) |
| density | 1.504±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -2.55±0.39(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C5H5Cl2N3/c1-2-9-4(6)3(8)5(7)10-2/h8H2,1H3 |
| InChIKey | FKRXXAMAHOGYNT-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(Cl)=C(N)C(Cl)=N1 |
| CAS DataBase Reference | 39906-04-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
