15629-92-2
| Name | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride |
| CAS | 15629-92-2 |
| EINECS(EC#) | 605-052-3 |
| Molecular Formula | C27H26Cl2NiP2 |
| MDL Number | MFCD00015318 |
| Molecular Weight | 542.04 |
| MOL File | 15629-92-2.mol |
Chemical Properties
| Appearance | red to red-brown powder or crystals |
| Melting point | 213 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | red |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Detection Methods | Elemental Analysis |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| InChI | InChI=1S/C27H26P2.2ClH.Ni/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;;;/h1-12,14-21H,13,22-23H2;2*1H;/q;;;+2/p-2 |
| InChIKey | ZBQUMMFUJLOTQC-UHFFFAOYSA-L |
| SMILES | P(C1=CC=CC=C1)(CCCP(C1C=CC=CC=1)C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl |
| CAS DataBase Reference | 15629-92-2(CAS DataBase Reference) |
| Storage Precautions | Moisture sensitive |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335-H350 |
| Precautionary statements | P201-P280-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3282 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 29319099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1A Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
;