6737-42-4
| Name | 1,3-Bis(diphenylphosphino)propane |
| CAS | 6737-42-4 |
| EINECS(EC#) | 229-791-2 |
| Molecular Formula | C27H26P2 |
| MDL Number | MFCD00003050 |
| Molecular Weight | 412.44 |
| MOL File | 6737-42-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 63-65 °C (lit.) |
| Boiling point | 529.7±33.0 °C(Predicted) |
| Fp | 235°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Granules or Powder |
| color | White to light yellow-beige |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC |
| BRN | 2821785 |
| InChI | InChI=1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2 |
| InChIKey | LVEYOSJUKRVCCF-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)CCCP(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 6737-42-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Bis(diphenylphosphino)propane(6737-42-4) |
| EPA Substance Registry System | 6737-42-4(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
