4-Bromo-2-methylpyridine
- Product Name4-Bromo-2-methylpyridine
- CAS22282-99-1
- MFC6H6BrN
- MW172.02
- EINECS624-896-3
- MOL File22282-99-1.mol
Chemical Properties
| Melting point | 26-27° |
| Boiling point | 76 °C / 14mmHg |
| Density | 1.450 g/mL at 25 °C |
| refractive index | n |
| Flash point | 174 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Dichloromethane |
| form | Pale Yellow Liquid |
| pka | 4.38±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Miscible with dichloromethane. Immiscible with water. |
| InChI | InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| InChIKey | JFBMFWHEXBLFCR-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 22282-99-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/39-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |