2-Picoline-N-oxide
- Product Name2-Picoline-N-oxide
- CAS931-19-1
- MFC6H7NO
- MW109.13
- EINECS213-230-3
- MOL File931-19-1.mol
Chemical Properties
| Melting point | 41-45 °C(lit.) |
| Boiling point | 259-261 °C |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5444 (estimate) |
| Flash point | >230 °F |
| storage temp. | RT, stored under nitrogen |
| form | powder to lump to clear liquid |
| pka | pK1:1.029(+1) (25°C) |
| color | White or Colorless to Light yellow |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 106916 |
| InChI | InChI=1S/C6H7NO/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| InChIKey | CFZKDDTWZYUZKS-UHFFFAOYSA-N |
| SMILES | C1(C)[N+]([O-])=CC=CC=1 |
| CAS DataBase Reference | 931-19-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2-methyl-, 1-oxide(931-19-1) |
| EPA Substance Registry System | 2-Methylpyridine-1-oxide (931-19-1) |
Safety Information
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-20/21/22-10 |
| Safety Statements | 26-36-24/25-16 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |