2-Trifluoromethyl-5-bromopyridine
- Product Name2-Trifluoromethyl-5-bromopyridine
- CAS436799-32-5
- MFC6H3BrF3N
- MW225.99
- EINECS
- MOL File436799-32-5.mol
Chemical Properties
| Melting point | 44-46 °C |
| Boiling point | 68-70°C 10mm |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Flash point | 174 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -1.80±0.22(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C6H3BrF3N/c7-4-1-2-5(11-3-4)6(8,9)10/h1-3H |
| InChIKey | RPFAUCIXZGMCFN-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 436799-32-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36/37/39-37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |