2-Bromo-4-(trifluoromethyl)pyridine
- Product Name2-Bromo-4-(trifluoromethyl)pyridine
- CAS175205-81-9
- MFC6H3BrF3N
- MW225.99
- EINECS672-057-5
- MOL File175205-81-9.mol
Chemical Properties
| Melting point | -21--20 °C |
| Boiling point | 84-85 °C/14 mmHg |
| Density | 1.827 g/mL at 25 °C |
| refractive index | n |
| Flash point | 164 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | -1.57±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H3BrF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H |
| InChIKey | WZVHLUMAQLUNTJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 175205-81-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-37/38-36 |
| Safety Statements | 26-36/37-45-37 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
