2-Bromo-4-(trifluoromethyl)pyridine
- Product Name2-Bromo-4-(trifluoromethyl)pyridine
- CAS175205-81-9
- CBNumberCB1385674
- MFC6H3BrF3N
- MW225.99
- EINECS672-057-5
- MDL NumberMFCD00153085
- MOL File175205-81-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -21--20 °C |
| Boiling point | 84-85 °C/14 mmHg |
| Density | 1.827 g/mL at 25 °C |
| refractive index | n |
| Flash point | 164 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | -1.57±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H3BrF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H |
| InChIKey | WZVHLUMAQLUNTJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 175205-81-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 25-36/37/38-37/38-36 | |||||||||
| Safety Statements | 26-36/37-45-37 | |||||||||
| RIDADR | UN 2810 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic/Irritant | |||||||||
| HazardClass | IRRITANT | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
