2-Fluoro-6-Chlorobenzonitrile
- Product Name2-Fluoro-6-Chlorobenzonitrile
- CAS668-45-1
- MFC7H3ClFN
- MW155.56
- EINECS211-571-2
- MOL File668-45-1.mol
Chemical Properties
| Melting point | 55-59 °C(lit.) |
| Boiling point | 104 °C11 mm Hg(lit.) |
| Density | 1.3760 (estimate) |
| Flash point | 104-105°C/11mm |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1940332 |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 668-45-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
