4-Chloro-2-fluorobenzonitrile
- Product Name4-Chloro-2-fluorobenzonitrile
- CAS57381-51-8
- MFC7H3ClFN
- MW155.56
- EINECS260-712-4
- MOL File57381-51-8.mol
Chemical Properties
| Melting point | 58-61 °C |
| Boiling point | 92/22mm |
| Density | 1.3760 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | insoluble |
| BRN | 4231142 |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | JRDMGVGCATYZPW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 57381-51-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T |
| Risk Statements | 36/37/38-20/21/22-36/38 |
| Safety Statements | 36/37/39-26-36-36/37 |
| RIDADR | 3439 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
