4-Chloro-2-fluorotoluene
- Product Name4-Chloro-2-fluorotoluene
- CAS452-75-5
- MFC7H6ClF
- MW144.57
- EINECS207-210-3
- MOL File452-75-5.mol
Chemical Properties
| Boiling point | 158 °C/743 mmHg (lit.) |
| Density | 1.186 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 124 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.186 |
| Water Solubility | INSOLUBLE |
| BRN | 1931682 |
| InChI | InChI=1S/C7H6ClF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | MKFCYQTVSDCXAQ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 452-75-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
