Tetrachloroterephthalonitrile
- Product NameTetrachloroterephthalonitrile
- CAS1897-41-2
- MFC8Cl4N2
- MW265.91
- EINECS401-550-8
- MOL File1897-41-2.mol
Chemical Properties
| Melting point | 308-312 °C(lit.) |
| Boiling point | 370.1±42.0 °C(Predicted) |
| Density | 1.71±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 |
| InChIKey | TXRVDQMSXQKAPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(Cl)C(Cl)=C(C#N)C(Cl)=C1Cl |
| CAS DataBase Reference | 1897-41-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 43-53-50/53 |
| Safety Statements | 24-37-61-60 |
| RIDADR | 3077 |
| WGK Germany | 1 |
| RTECS | TI8275000 |
| HS Code | 2926.90.4801 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
