2-Chloro-4-fluorobenzonitrile
- Product Name2-Chloro-4-fluorobenzonitrile
- CAS60702-69-4
- MFC7H3ClFN
- MW155.56
- EINECS262-384-8
- MOL File60702-69-4.mol
Chemical Properties
| Melting point | 64-66 °C(lit.) |
| Boiling point | 233.4±20.0 °C(Predicted) |
| Density | 1.3760 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 6323034 |
| InChI | InChI=1S/C7H3ClFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H |
| InChIKey | PGKPNNMOFHNZJX-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 60702-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-fluorobenzonitrile(60702-69-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
