3-Chloro-2-fluorobenzonitrile
- Product Name3-Chloro-2-fluorobenzonitrile
- CAS94087-40-8
- MFC7H3ClFN
- MW155.56
- EINECS301-934-4
- MOL File94087-40-8.mol
Chemical Properties
| Melting point | 40-44 °C(lit.) |
| Boiling point | 206.3±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point | 164 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H3ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H |
| InChIKey | CHKLNKWJIDQKFV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 94087-40-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3-chloro-2-fluoro-(94087-40-8) |
Safety Information
| Hazard Codes | Xn,T,Xi,N |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation |
