3-Chloro-2-fluorobenzoic acid
- Product Name3-Chloro-2-fluorobenzoic acid
- CAS161957-55-7
- MFC7H4ClFO2
- MW174.56
- EINECS630-303-9
- MOL File161957-55-7.mol
Chemical Properties
| Melting point | 177-180 °C (lit.) |
| Boiling point | 278.9±20.0 °C(Predicted) |
| Density | 1.477±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.90±0.10(Predicted) |
| color | White to Light yellow to Light red |
| BRN | 7127637 |
| InChI | InChI=1S/C7H4ClFO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
| InChIKey | FCSSYEWURMTUSM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 161957-55-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
