3-Chloro-2,4,5-trifluorobenzoic acid
- Product Name3-Chloro-2,4,5-trifluorobenzoic acid
- CAS101513-77-3
- MFC7H2ClF3O2
- MW210.54
- EINECS630-223-4
- MOL File101513-77-3.mol
Chemical Properties
| Melting point | 112-116 °C (lit.) |
| Boiling point | 272℃ |
| Density | 1.663±0.06 g/cm3(Predicted) |
| Flash point | 118°(244°F) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.50±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C7H2ClF3O2/c8-4-5(10)2(7(12)13)1-3(9)6(4)11/h1H,(H,12,13) |
| InChIKey | KBESHLYCSZINAJ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(F)c(F)c(Cl)c1F |
| CAS DataBase Reference | 101513-77-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-R36/37/38 |
| Safety Statements | 37/39-26-26 37/39-36-S37/39-S26-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
