3,5-Bis(trifluoromethyl)phenylacetonitrile
- Product Name3,5-Bis(trifluoromethyl)phenylacetonitrile
- CAS85068-32-2
- MFC10H5F6N
- MW253.14
- EINECS285-294-0
- MOL File85068-32-2.mol
Chemical Properties
| Boiling point | 195.4±35.0 °C(Predicted) |
| Density | 1.42 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| solubility | Difficult to mix. |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Specific Gravity | 1.420 |
| BRN | 6810362 |
| InChI | 1S/C10H5F6N/c11-9(12,13)7-3-6(1-2-17)4-8(5-7)10(14,15)16/h3-5H,1H2 |
| InChIKey | YXGWYBUKRTYHJM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(CC#N)cc(c1)C(F)(F)F |
| CAS DataBase Reference | 85068-32-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,C,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |