4-Methylbenzyl cyanide
- Product Name4-Methylbenzyl cyanide
- CAS2947-61-7
- MFC9H9N
- MW131.17
- EINECS220-963-2
- MOL File2947-61-7.mol
Chemical Properties
| Melting point | 15 °C |
| Boiling point | 245 °C |
| Density | 0.99 |
| refractive index | 1.51 |
| Flash point | 106 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Specific Gravity | 0.99 |
| BRN | 1099645 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C9H9N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6H2,1H3 |
| InChIKey | RNHKXHKUKJXLAU-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=C(C)C=C1 |
| CAS DataBase Reference | 2947-61-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetonitrile, 4-methyl-(2947-61-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37-24/25 |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 |
