4-Bromobenzotrifluoride
- Product Name4-Bromobenzotrifluoride
- CAS402-43-7
- MFC7H4BrF3
- MW225.01
- EINECS206-943-6
- MOL File402-43-7.mol
Chemical Properties
| Boiling point | 154-155 °C(lit.) |
| Density | 1.607 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 120 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Not miscible or difficult to mix. |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.607 |
| BRN | 2045666 |
| InChI | InChI=1S/C7H4BrF3/c8-6-3-1-5(2-4-6)7(9,10)11/h1-4H |
| InChIKey | XLQSXGGDTHANLN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 402-43-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-(trifluoromethyl)-(402-43-7) |
| EPA Substance Registry System | Benzene, 1-bromo-4-(trifluoromethyl)- (402-43-7) |
Safety Information
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29036990 |
