3,5-Bis(trifluoromethyl)bromobenzene
- Product Name3,5-Bis(trifluoromethyl)bromobenzene
- CAS328-70-1
- MFC8H3BrF6
- MW293
- EINECS206-334-5
- MOL File328-70-1.mol
Chemical Properties
| Melting point | −16 °C(lit.) |
| Boiling point | 154 °C(lit.) |
| Density | 1.699 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Liquid |
| Specific Gravity | 1.699 |
| color | Clear colorless to slightly yellow |
| Water Solubility | Immiscible with water. |
| BRN | 2123669 |
| InChI | 1S/C8H3BrF6/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | CSVCVIHEBDJTCJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Br)cc(c1)C(F)(F)F |
| CAS DataBase Reference | 328-70-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)bromobenzene(328-70-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
