3,5-Bis(trifluoromethyl)phenol
- Product Name3,5-Bis(trifluoromethyl)phenol
- CAS349-58-6
- MFC8H4F6O
- MW230.11
- EINECS206-488-3
- MOL File349-58-6.mol
Chemical Properties
| Melting point | 20-21 °C(lit.) |
| Boiling point | 97 °C50 mm Hg(lit.) |
| Density | 1.511 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 7.96±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.511 |
| BRN | 2123670 |
| InChI | 1S/C8H4F6O/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3,15H |
| InChIKey | ODSXJQYJADZFJX-UHFFFAOYSA-N |
| SMILES | Oc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 349-58-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Xylenol, aplha,aplha,aplha,aplha',aplha',aplha'-hexafluoro-(349-58-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |