1,3-Bis(trifluoromethyl)-benzene
- Product Name1,3-Bis(trifluoromethyl)-benzene
- CAS402-31-3
- MFC8H4F6
- MW214.11
- EINECS206-939-4
- MOL File402-31-3.mol
Chemical Properties
| Melting point | -35°C |
| Boiling point | 116-116.3 °C(lit.) |
| Density | 1.378 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 26 °C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.378 |
| Water Solubility | Insoluble in water. Soluble in alcohol, ether, benzene. |
| BRN | 2052589 |
| Dielectric constant | 5.9800000000000004 |
| InChI | 1S/C8H4F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-4H |
| InChIKey | SJBBXFLOLUTGCW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(c1)C(F)(F)F |
| LogP | 3.83 |
| CAS DataBase Reference | 402-31-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-bis(trifluoromethyl)-(402-31-3) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
