| Melting point |
155-158 °C(lit.) |
| Boiling point |
314.0±42.0 °C(Predicted) |
| Density |
1.40 g/cm3 |
| refractive index |
1.51 |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
water: 100 mg/mL, clear to hazy, colorless to light yellow |
| Water Solubility |
almost transparency in Water |
| pka |
13.04±0.70(Predicted) |
| form |
Powder |
| color |
White |
| optical activity |
[α]20/D -66.5 to -64.5, c =10% (w/v) in water |
| biological source |
synthetic (organic) |
| InChI |
InChI=1/C6H12O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3-9H,2H2,1H3/t3-,4+,5-,6-/s3 |
| InChIKey |
ZBDGHWFPLXXWRD-DQCLPXBLNA-N |
| SMILES |
[C@@H]1(OC)OC[C@@H](O)[C@H](O)[C@H]1O |&1:0,5,7,9,r| |
| CAS DataBase Reference |
612-05-5(CAS DataBase Reference) |
| EPA Substance Registry System |
.beta.-D-Xylopyranoside, methyl (612-05-5) |
