| Melting point |
165-168 °C |
| Boiling point |
442.39°C (rough estimate) |
| Density |
1.3709 (rough estimate) |
| refractive index |
-102.5 ° (C=1, H2O) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
Methanol (Slightly, Sonicated), Water (Slightly) |
| form |
Powder |
| pka |
12.55±0.70(Predicted) |
| color |
White to yellow |
| Water Solubility |
Soluble in water, methanol, warm ethanol, dimethyl sulfoxide and dimethylformamide. Insoluble in ether. |
| BRN |
92211 |
| Stability |
Hygroscopic |
| InChI |
1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey |
IFBHRQDFSNCLOZ-RMPHRYRLSA-N |
| SMILES |
OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP |
-0.550 (est) |
| CAS DataBase Reference |
2492-87-7(CAS DataBase Reference) |
| EPA Substance Registry System |
.beta.-D-Glucopyranoside, 4-nitrophenyl (2492-87-7) |
