| Melting point |
176-178 °C(lit.) |
| Boiling point |
359.49°C (rough estimate) |
| Density |
1.2993 (rough estimate) |
| refractive index |
-70.5 ° (C=2, H2O) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Methanol (Slightly), Water (Slightly, Sonicated) |
| form |
Powder |
| pka |
12.70±0.70(Predicted) |
| color |
White to Off-white |
| optical activity |
[α]25/D 70°, c = 1 in H2O |
| Water Solubility |
Soluble in water |
| BRN |
87517 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
1S/C12H16O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey |
NEZJDVYDSZTRFS-RMPHRYRLSA-N |
| SMILES |
OC[C@H]1O[C@@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference |
1464-44-4(CAS DataBase Reference) |
| EPA Substance Registry System |
.beta.-D-Glucopyranoside, phenyl (1464-44-4) |
