| Melting point |
210-216 °C |
| Boiling point |
442.39°C (rough estimate) |
| Density |
1.3709 (rough estimate) |
| refractive index |
218.5 ° (C=0.5, H2O) |
| storage temp. |
Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility |
DMF: 10 mg/ml,DMSO: 10 mg/ml,Ethanol: Slightly soluble,PBS (pH 7.2): 0.3 mg/ml |
| form |
Crystalline Powder |
| pka |
12.55±0.70(Predicted) |
| color |
Off-white to light yellow |
| Water Solubility |
Soluble in water, warm ethanol and methanol. |
| BRN |
92212 |
| InChI |
InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12+/s3 |
| InChIKey |
IFBHRQDFSNCLOZ-ZIQFBCGOSA-N |
| SMILES |
O(C1C=CC(N(=O)=O)=CC=1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:10,12,15,17,19,r| |
| CAS DataBase Reference |
3767-28-0(CAS DataBase Reference) |
