Zeaxanthin
- Product NameZeaxanthin
- CAS144-68-3
- MFC40H56O2
- MW568.87
- EINECS205-636-4
- MOL File144-68-3.mol
Chemical Properties
| Melting point | 203-2050C |
| Boiling point | 572.66°C (rough estimate) |
| Density | 0.9944 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.60±0.70(Predicted) |
| form | Solid |
| color | Light Orange to Very Dark Red |
| Odor | Special Odor |
| Stability | Light Sensitive, Temperature Sensitive |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChIKey | JKQXZKUSFCKOGQ-SLJWWQRENA-N |
| SMILES | C1(/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2C(C)(C)C[C@H](O)CC=2C)C(C)(C)C[C@H](O)CC=1C |&1:28,37,r| |
| LogP | 14.950 (est) |
| CAS DataBase Reference | 144-68-3(CAS DataBase Reference) |
Safety Information
| WGK Germany | - |
| F | 3-8-10 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
