Diclofenac Sodium Salt
- Product NameDiclofenac Sodium Salt
- CAS15307-79-6
- MFC14H10Cl2NNaO2
- MW318.13
- EINECS239-346-4
- MOL File15307-79-6.mol
Chemical Properties
| Melting point | 288-290°C |
| Density | 0.781 g/cm3 |
| storage temp. | room temp |
| solubility | H2O: 50 mg/mL |
| form | White solid |
| pka | 4(at 25℃) |
| color | White to Almost white |
| biological source | synthetic |
| Water Solubility | Soluble in water to 50mg/ml. |
| Merck | 14,3081 |
| BCS Class | 2 |
| Stability | Stable. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
| InChIKey | KPHWPUGNDIVLNH-UHFFFAOYSA-M |
| SMILES | C1(=CC=CC=C1CC([O-])=O)NC1=C(Cl)C=CC=C1Cl.[Na+] |
| CAS DataBase Reference | 15307-79-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-63 |
| Safety Statements | 22-36/37-45-36-26-60-20 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AG6330000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Repr. 2 STOT RE 1 |
| Toxicity | LD50 in mice, rats (mg/kg): ~390, 150 orally (Krupp) |
